C16H21F2N5O2S2 — CID 169128400
(3aS,6aS)-2-[5-(difluoromethyl)-1-methylpyrazol-4-yl]sulfonyl-5-(1-methylimidazol-2-yl)sulfanyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 169128400) has the molecular formula C16H21F2N5O2S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (3aS,6aS)-2-[5-(difluoromethyl)-1-methylpyrazol-4-yl]sulfonyl-5-(1-methylimidazol-2-yl)sulfanyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aS,6aS)-2-[5-(difluoromethyl)-1-methylpyrazol-4-yl]sulfonyl-5-(1-methylimidazol-2-yl)sulfanyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 169128400 |
| Molecular Formula | C16H21F2N5O2S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (3aS,6aS)-2-[5-(difluoromethyl)-1-methylpyrazol-4-yl]sulfonyl-5-(1-methylimidazol-2-yl)sulfanyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Cn1ccnc1SC1C[C@@H]2CN(S(=O)(=O)c3cnn(C)c3C(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C16H21F2N5O2S2/c1-21-4-3-19-16(21)26-12-5-10-8-23(9-11(10)6-12)27(24,25)13-7-20-22(2)14(13)15(17)18/h3-4,7,10-12,15H,5-6,8-9H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | RUYOUJUBKVXNQV-GHMZBOCLSA-N |
| XLogP | 2.28 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |