C15H11Cl2IN4O2 — CID 169128924
4-chloro-2-[[3-[2-(4-chlorophenyl)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-5-iodopyridazin-3-one (PubChem CID 169128924) has the molecular formula C15H11Cl2IN4O2 and a molecular weight of 477.09 g/mol. Its IUPAC name is 4-chloro-2-[[3-[2-(4-chlorophenyl)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-5-iodopyridazin-3-one.
| Compound Name | 4-chloro-2-[[3-[2-(4-chlorophenyl)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-5-iodopyridazin-3-one |
|---|---|
| PubChem CID | 169128924 |
| Molecular Formula | C15H11Cl2IN4O2 |
| Molecular Weight | 477.09 g/mol |
| Exact Mass | 475.93 |
| IUPAC Name | 4-chloro-2-[[3-[2-(4-chlorophenyl)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-5-iodopyridazin-3-one |
| SMILES | O=c1c(Cl)c(I)cnn1Cc1nc(CCc2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C15H11Cl2IN4O2/c16-10-4-1-9(2-5-10)3-6-12-20-13(24-21-12)8-22-15(23)14(17)11(18)7-19-22/h1-2,4-5,7H,3,6,8H2 |
| InChIKey | OWFYZTIUDHNICQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.09 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|