About 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile
1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile (PubChem CID 169129319) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile.
Molecular Properties
| Compound Name | 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile |
| PubChem CID | 169129319 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile |
| SMILES | Cc1c(C#N)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C8H9N3O2/c1-5-6(4-9)10(2)8(13)11(3)7(5)12/h1-3H3 |
| InChIKey | IMMJBCAIQPBEFI-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile?
The IUPAC name of 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile (CID 169129319) is 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile.
What is the SMILES notation for 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile?
The canonical SMILES for 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile is Cc1c(C#N)n(C)c(=O)n(C)c1=O.
What is the InChIKey of 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile?
The InChIKey is IMMJBCAIQPBEFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-5-6(4-9)10(2)8(13)11(3)7(5)12/h1-3H3.
What are the key properties of 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile?
1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile has a molecular weight of 179.18 g/mol, XLogP of -0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trimethyl-2,6-dioxopyrimidine-4-carbonitrile is sourced from PubChem (CID 169129319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).