C44H41F2N7O2 — CID 169129367
tert-butyl 3-[[3,5-difluoro-6-[7-(3-tritylimidazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 169129367) has the molecular formula C44H41F2N7O2 and a molecular weight of 737.86 g/mol. Its IUPAC name is tert-butyl 3-[[3,5-difluoro-6-[7-(3-tritylimidazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-2-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[3,5-difluoro-6-[7-(3-tritylimidazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-2-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169129367 |
| Molecular Formula | C44H41F2N7O2 |
| Molecular Weight | 737.86 g/mol |
| Exact Mass | 737.33 |
| IUPAC Name | tert-butyl 3-[[3,5-difluoro-6-[7-(3-tritylimidazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Nc2nc(-c3cnc4cc(-c5cncn5C(c5ccccc5)(c5ccccc5)c5ccccc5)ccn34)c(F)cc2F)C1 |
| InChI | InChI=1S/C44H41F2N7O2/c1-43(2,3)55-42(54)51-22-13-20-34(28-51)49-41-36(46)25-35(45)40(50-41)38-27-48-39-24-30(21-23-52(38)39)37-26-47-29-53(37)44(31-14-7-4-8-15-31,32-16-9-5-10-17-32)33-18-11-6-12-19-33/h4-12,14-19,21,23-27,29,34H,13,20,22,28H2,1-3H3,(H,49,50) |
| InChIKey | GDWZPXUOOYMZSF-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.86 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|