C20H24N5O2+ — CID 169130176
1-[4-(1-methyl-2-oxopyrazolidin-2-ium-3-yl)-2-phenyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]propan-1-one (PubChem CID 169130176) has the molecular formula C20H24N5O2+ and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-[4-(1-methyl-2-oxopyrazolidin-2-ium-3-yl)-2-phenyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]propan-1-one.
| Compound Name | 1-[4-(1-methyl-2-oxopyrazolidin-2-ium-3-yl)-2-phenyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]propan-1-one |
|---|---|
| PubChem CID | 169130176 |
| Molecular Formula | C20H24N5O2+ |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-[4-(1-methyl-2-oxopyrazolidin-2-ium-3-yl)-2-phenyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]propan-1-one |
| SMILES | CCC(=O)N1CCc2c(nc(-c3ccccc3)nc2C2CCN(C)[N+]2=O)C1 |
| InChI | InChI=1S/C20H24N5O2/c1-3-18(26)24-12-9-15-16(13-24)21-20(14-7-5-4-6-8-14)22-19(15)17-10-11-23(2)25(17)27/h4-8,17H,3,9-13H2,1-2H3/q+1 |
| InChIKey | WVQZDAYNQVIZDE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|