About CID 169130930
CID 169130930 (PubChem CID 169130930) has the molecular formula C6H3BClF2N
and a molecular weight of 173.36 g/mol.
Molecular Properties
| Compound Name | CID 169130930 |
| PubChem CID | 169130930 |
| Molecular Formula | C6H3BClF2N |
| Molecular Weight | 173.36 g/mol |
| Exact Mass | 173.00 |
| IUPAC Name | — |
| SMILES | [B]C(Cl)c1ncc(F)cc1F |
| InChI | InChI=1S/C6H3BClF2N/c7-6(8)5-4(10)1-3(9)2-11-5/h1-2,6H |
| InChIKey | JQDITTMIQNKKOF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169130930 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169130930?
The IUPAC name of CID 169130930 (CID 169130930) is not available.
What is the SMILES notation for CID 169130930?
The canonical SMILES for CID 169130930 is [B]C(Cl)c1ncc(F)cc1F.
What is the InChIKey of CID 169130930?
The InChIKey is JQDITTMIQNKKOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BClF2N/c7-6(8)5-4(10)1-3(9)2-11-5/h1-2,6H.
What are the key properties of CID 169130930?
CID 169130930 has a molecular weight of 173.36 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169130930 is sourced from PubChem (CID 169130930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).