About CID 169130932
CID 169130932 (PubChem CID 169130932) has the molecular formula C19H13BClF2N3O4
and a molecular weight of 431.59 g/mol.
Molecular Properties
| Compound Name | CID 169130932 |
| PubChem CID | 169130932 |
| Molecular Formula | C19H13BClF2N3O4 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | — |
| SMILES | [B]C(Oc1cc(C)n(-c2cc(C(=O)O)ncc2C)c(=O)c1Cl)c1ncc(F)cc1F |
| InChI | InChI=1S/C19H13BClF2N3O4/c1-8-6-24-12(19(28)29)5-13(8)26-9(2)3-14(15(21)18(26)27)30-17(20)16-11(23)4-10(22)7-25-16/h3-7,17H,1-2H3,(H,28,29) |
| InChIKey | YXZHCDTWSCMZJM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169130932 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169130932?
The IUPAC name of CID 169130932 (CID 169130932) is not available.
What is the SMILES notation for CID 169130932?
The canonical SMILES for CID 169130932 is [B]C(Oc1cc(C)n(-c2cc(C(=O)O)ncc2C)c(=O)c1Cl)c1ncc(F)cc1F.
What is the InChIKey of CID 169130932?
The InChIKey is YXZHCDTWSCMZJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13BClF2N3O4/c1-8-6-24-12(19(28)29)5-13(8)26-9(2)3-14(15(21)18(26)27)30-17(20)16-11(23)4-10(22)7-25-16/h3-7,17H,1-2H3,(H,28,29).
What are the key properties of CID 169130932?
CID 169130932 has a molecular weight of 431.59 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169130932 is sourced from PubChem (CID 169130932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).