About CID 169131166
CID 169131166 (PubChem CID 169131166) has the molecular formula C40H43Pb2S2+
and a molecular weight of 1002.32 g/mol.
Molecular Properties
| Compound Name | CID 169131166 |
| PubChem CID | 169131166 |
| Molecular Formula | C40H43Pb2S2+ |
| Molecular Weight | 1002.32 g/mol |
| Exact Mass | 1003.23 |
| IUPAC Name | — |
| SMILES | CC.CCc1cc(CC)cc(C2=C(/C=C/C(=C/C[Pb])c3ccccc3[SH2+])CCC/C2=C\C=C2/C=C([Pb])Sc3ccccc32)c1 |
| InChI | InChI=1S/C38H36S2.C2H6.2Pb/c1-4-27-24-28(5-2)26-33(25-27)38-31(20-18-29(6-3)34-14-7-9-16-36(34)39)12-11-13-32(38)21-19-30-22-23-40-37-17-10-8-15-35(30)37;1-2;;/h6-10,14-22,24-26,39H,3-5,11-13H2,1-2H3;1-2H3;;/p+1/b20-18+,29-6-,30-19+,32-21+;;; |
| InChIKey | ADMLDYPIBBKZPD-CXFNSGMSSA-O |
| XLogP | 10.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1002.32 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 169131166 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169131166?
The IUPAC name of CID 169131166 (CID 169131166) is not available.
What is the SMILES notation for CID 169131166?
The canonical SMILES for CID 169131166 is CC.CCc1cc(CC)cc(C2=C(/C=C/C(=C/C[Pb])c3ccccc3[SH2+])CCC/C2=C\C=C2/C=C([Pb])Sc3ccccc32)c1.
What is the InChIKey of CID 169131166?
The InChIKey is ADMLDYPIBBKZPD-CXFNSGMSSA-O. The full InChI is InChI=1S/C38H36S2.C2H6.2Pb/c1-4-27-24-28(5-2)26-33(25-27)38-31(20-18-29(6-3)34-14-7-9-16-36(34)39)12-11-13-32(38)21-19-30-22-23-40-37-17-10-8-15-35(30)37;1-2;;/h6-10,14-22,24-26,39H,3-5,11-13H2,1-2H3;1-2H3;;/p+1/b20-18+,29-6-,30-19+,32-21+;;;.
What are the key properties of CID 169131166?
CID 169131166 has a molecular weight of 1002.32 g/mol, XLogP of 10.50, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169131166 is sourced from PubChem (CID 169131166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).