C13H21NO2 — CID 169131301
(3S,7aS)-3-tert-butyl-7a-cyclopropyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one (PubChem CID 169131301) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (3S,7aS)-3-tert-butyl-7a-cyclopropyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one.
| Compound Name | (3S,7aS)-3-tert-butyl-7a-cyclopropyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
|---|---|
| PubChem CID | 169131301 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (3S,7aS)-3-tert-butyl-7a-cyclopropyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
| SMILES | CC(C)(C)[C@@H]1OC(=O)[C@@]2(C3CC3)CCCN12 |
| InChI | InChI=1S/C13H21NO2/c1-12(2,3)10-14-8-4-7-13(14,9-5-6-9)11(15)16-10/h9-10H,4-8H2,1-3H3/t10-,13-/m0/s1 |
| InChIKey | HBYXLEBOVWKLBG-GWCFXTLKSA-N |
| XLogP | 2.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |