About [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol
[(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol (PubChem CID 169131326) has the molecular formula C8H16FNO
and a molecular weight of 161.22 g/mol. Its IUPAC name is [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol |
| PubChem CID | 169131326 |
| Molecular Formula | C8H16FNO |
| Molecular Weight | 161.22 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol |
| SMILES | CN1CC[C@@H](CF)[C@]1(C)CO |
| InChI | InChI=1S/C8H16FNO/c1-8(6-11)7(5-9)3-4-10(8)2/h7,11H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | VOTCFJHUVJMHFT-YUMQZZPRSA-N |
| XLogP | 0.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol?
The IUPAC name of [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol (CID 169131326) is [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol?
The canonical SMILES for [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol is CN1CC[C@@H](CF)[C@]1(C)CO.
What is the InChIKey of [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol?
The InChIKey is VOTCFJHUVJMHFT-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H16FNO/c1-8(6-11)7(5-9)3-4-10(8)2/h7,11H,3-6H2,1-2H3/t7-,8-/m0/s1.
What are the key properties of [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol?
[(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol has a molecular weight of 161.22 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-3-(fluoromethyl)-1,2-dimethylpyrrolidin-2-yl]methanol is sourced from PubChem (CID 169131326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).