C39H24N4O2S — CID 169131778
3-[4-(3-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophene 5,5-dioxide (PubChem CID 169131778) has the molecular formula C39H24N4O2S and a molecular weight of 612.71 g/mol. Its IUPAC name is 3-[4-(3-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophene 5,5-dioxide.
| Compound Name | 3-[4-(3-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 169131778 |
| Molecular Formula | C39H24N4O2S |
| Molecular Weight | 612.71 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | 3-[4-(3-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophene 5,5-dioxide |
| SMILES | O=S1(=O)c2ccccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc(-n5c6ccccc6c6ccccc65)c4)n3)cc21 |
| InChI | InChI=1S/C39H24N4O2S/c44-46(45)35-20-9-6-17-31(35)32-22-21-27(24-36(32)46)39-41-37(25-11-2-1-3-12-25)40-38(42-39)26-13-10-14-28(23-26)43-33-18-7-4-15-29(33)30-16-5-8-19-34(30)43/h1-24H |
| InChIKey | DROKWARCFAYYDB-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.71 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |