C10H19NO — CID 169132453
N-methyl-N-[(3S)-3-methylcyclohexyl]acetamide (PubChem CID 169132453) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is N-methyl-N-[(3S)-3-methylcyclohexyl]acetamide.
| Compound Name | N-methyl-N-[(3S)-3-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 169132453 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N-methyl-N-[(3S)-3-methylcyclohexyl]acetamide |
| SMILES | CC(=O)N(C)C1CCC[C@H](C)C1 |
| InChI | InChI=1S/C10H19NO/c1-8-5-4-6-10(7-8)11(3)9(2)12/h8,10H,4-7H2,1-3H3/t8-,10?/m0/s1 |
| InChIKey | ZPEPJDDUZQWSDY-PEHGTWAWSA-N |
| XLogP | 2.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |