C29H26FN3O3S2 — CID 169134032
[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1,3-thiazol-4-yl]methanol (PubChem CID 169134032) has the molecular formula C29H26FN3O3S2 and a molecular weight of 547.68 g/mol. Its IUPAC name is [2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 169134032 |
| Molecular Formula | C29H26FN3O3S2 |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | [2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1,3-thiazol-4-yl]methanol |
| SMILES | COCCOc1cc(F)ccc1-c1c(-c2nc(CO)cs2)nc(-c2ccc3c(c2)CCNC3)c2ccsc12 |
| InChI | InChI=1S/C29H26FN3O3S2/c1-35-9-10-36-24-13-20(30)4-5-22(24)25-27(29-32-21(15-34)16-38-29)33-26(23-7-11-37-28(23)25)18-2-3-19-14-31-8-6-17(19)12-18/h2-5,7,11-13,16,31,34H,6,8-10,14-15H2,1H3 |
| InChIKey | XNZBOSZJKLCMNH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|