C32H28F2N6O3S — CID 169134051
N-[1-[3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(1-methylindazol-5-yl)thieno[3,2-c]pyridin-6-yl]-1H-pyrazol-5-yl]ethyl]prop-2-enamide (PubChem CID 169134051) has the molecular formula C32H28F2N6O3S and a molecular weight of 614.68 g/mol. Its IUPAC name is N-[1-[3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(1-methylindazol-5-yl)thieno[3,2-c]pyridin-6-yl]-1H-pyrazol-5-yl]ethyl]prop-2-enamide.
| Compound Name | N-[1-[3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(1-methylindazol-5-yl)thieno[3,2-c]pyridin-6-yl]-1H-pyrazol-5-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 169134051 |
| Molecular Formula | C32H28F2N6O3S |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | N-[1-[3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(1-methylindazol-5-yl)thieno[3,2-c]pyridin-6-yl]-1H-pyrazol-5-yl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)c1cc(-c2nc(-c3ccc4c(cnn4C)c3)c3ccsc3c2-c2c(F)cc(F)cc2OCCOC)n[nH]1 |
| InChI | InChI=1S/C32H28F2N6O3S/c1-5-27(41)36-17(2)23-15-24(39-38-23)31-29(28-22(34)13-20(33)14-26(28)43-10-9-42-4)32-21(8-11-44-32)30(37-31)18-6-7-25-19(12-18)16-35-40(25)3/h5-8,11-17H,1,9-10H2,2-4H3,(H,36,41)(H,38,39) |
| InChIKey | PHPINTAWXGAYNI-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|