C35H30FN5O3S — CID 169134125
N-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-3H-benzimidazol-5-yl]prop-2-enamide (PubChem CID 169134125) has the molecular formula C35H30FN5O3S and a molecular weight of 619.72 g/mol. Its IUPAC name is N-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-3H-benzimidazol-5-yl]prop-2-enamide.
| Compound Name | N-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-3H-benzimidazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 169134125 |
| Molecular Formula | C35H30FN5O3S |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | N-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-3H-benzimidazol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2nc(-c3nc(-c4ccc5c(c4)CCNC5)c4ccsc4c3-c3ccc(F)cc3OCCOC)[nH]c2c1 |
| InChI | InChI=1S/C35H30FN5O3S/c1-3-30(42)38-24-7-9-27-28(18-24)40-35(39-27)33-31(25-8-6-23(36)17-29(25)44-14-13-43-2)34-26(11-15-45-34)32(41-33)21-4-5-22-19-37-12-10-20(22)16-21/h3-9,11,15-18,37H,1,10,12-14,19H2,2H3,(H,38,42)(H,39,40) |
| InChIKey | VJTXZFUHXVOGDO-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|