C34H28FN3O4S — CID 169134133
N-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(3-oxo-2,4-dihydro-1H-isoquinolin-7-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide (PubChem CID 169134133) has the molecular formula C34H28FN3O4S and a molecular weight of 593.68 g/mol. Its IUPAC name is N-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(3-oxo-2,4-dihydro-1H-isoquinolin-7-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(3-oxo-2,4-dihydro-1H-isoquinolin-7-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 169134133 |
| Molecular Formula | C34H28FN3O4S |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | N-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(3-oxo-2,4-dihydro-1H-isoquinolin-7-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(-c3ccc4c(c3)CNC(=O)C4)c3ccsc3c2-c2ccc(F)cc2OCCOC)c1 |
| InChI | InChI=1S/C34H28FN3O4S/c1-3-29(39)37-25-6-4-5-21(16-25)33-31(26-10-9-24(35)18-28(26)42-13-12-41-2)34-27(11-14-43-34)32(38-33)22-8-7-20-17-30(40)36-19-23(20)15-22/h3-11,14-16,18H,1,12-13,17,19H2,2H3,(H,36,40)(H,37,39) |
| InChIKey | CGUBBVSPHQVECP-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|