C33H28F2N6O3S — CID 169134205
1-[(4R)-2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-imidazo[1,2-a]pyridin-6-ylthieno[3,2-c]pyridin-6-yl]-4-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one (PubChem CID 169134205) has the molecular formula C33H28F2N6O3S and a molecular weight of 626.69 g/mol. Its IUPAC name is 1-[(4R)-2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-imidazo[1,2-a]pyridin-6-ylthieno[3,2-c]pyridin-6-yl]-4-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one.
| Compound Name | 1-[(4R)-2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-imidazo[1,2-a]pyridin-6-ylthieno[3,2-c]pyridin-6-yl]-4-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169134205 |
| Molecular Formula | C33H28F2N6O3S |
| Molecular Weight | 626.69 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | 1-[(4R)-2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-imidazo[1,2-a]pyridin-6-ylthieno[3,2-c]pyridin-6-yl]-4-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCn2nc(-c3nc(-c4ccc5nccn5c4)c4ccsc4c3-c3c(F)cc(F)cc3OCCOC)cc2[C@H]1C |
| InChI | InChI=1S/C33H28F2N6O3S/c1-4-28(42)40-10-11-41-25(19(40)2)17-24(38-41)32-30(29-23(35)15-21(34)16-26(29)44-13-12-43-3)33-22(7-14-45-33)31(37-32)20-5-6-27-36-8-9-39(27)18-20/h4-9,14-19H,1,10-13H2,2-3H3/t19-/m1/s1 |
| InChIKey | JNTIPOLMMGHQEK-LJQANCHMSA-N |
| XLogP | 6.53 |
| TPSA | 86.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.69 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|