C37H36FN3O3S — CID 169134289
N-[3-[4-[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-7-[4-fluoro-2-(2-methoxyethoxy)phenyl]thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide (PubChem CID 169134289) has the molecular formula C37H36FN3O3S and a molecular weight of 621.78 g/mol. Its IUPAC name is N-[3-[4-[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-7-[4-fluoro-2-(2-methoxyethoxy)phenyl]thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[4-[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-7-[4-fluoro-2-(2-methoxyethoxy)phenyl]thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 169134289 |
| Molecular Formula | C37H36FN3O3S |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | N-[3-[4-[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-7-[4-fluoro-2-(2-methoxyethoxy)phenyl]thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(-c3ccc4c(c3)CCC(N(C)C)C4)c3ccsc3c2-c2ccc(F)cc2OCCOC)c1 |
| InChI | InChI=1S/C37H36FN3O3S/c1-5-33(42)39-28-8-6-7-25(20-28)36-34(30-14-12-27(38)22-32(30)44-17-16-43-4)37-31(15-18-45-37)35(40-36)26-10-9-24-21-29(41(2)3)13-11-23(24)19-26/h5-10,12,14-15,18-20,22,29H,1,11,13,16-17,21H2,2-4H3,(H,39,42) |
| InChIKey | JUDUVWIEEWQWEI-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|