C37H35FN4O4S2 — CID 169134296
tert-butyl 6-[7-(4-fluoro-2-methoxyphenyl)-6-(5-prop-2-enoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)thieno[3,2-c]pyridin-4-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 169134296) has the molecular formula C37H35FN4O4S2 and a molecular weight of 682.84 g/mol. Its IUPAC name is tert-butyl 6-[7-(4-fluoro-2-methoxyphenyl)-6-(5-prop-2-enoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)thieno[3,2-c]pyridin-4-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 6-[7-(4-fluoro-2-methoxyphenyl)-6-(5-prop-2-enoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)thieno[3,2-c]pyridin-4-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 169134296 |
| Molecular Formula | C37H35FN4O4S2 |
| Molecular Weight | 682.84 g/mol |
| Exact Mass | 682.21 |
| IUPAC Name | tert-butyl 6-[7-(4-fluoro-2-methoxyphenyl)-6-(5-prop-2-enoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)thieno[3,2-c]pyridin-4-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C=CC(=O)N1CCc2nc(-c3nc(-c4ccc5c(c4)CCN(C(=O)OC(C)(C)C)C5)c4ccsc4c3-c3ccc(F)cc3OC)sc2C1 |
| InChI | InChI=1S/C37H35FN4O4S2/c1-6-30(43)41-15-12-27-29(20-41)48-35(39-27)33-31(25-10-9-24(38)18-28(25)45-5)34-26(13-16-47-34)32(40-33)22-7-8-23-19-42(14-11-21(23)17-22)36(44)46-37(2,3)4/h6-10,13,16-18H,1,11-12,14-15,19-20H2,2-5H3 |
| InChIKey | PVDATHHKZIRIIV-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.84 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|