About ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine
ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine (PubChem CID 169134554) has the molecular formula C21H49N3
and a molecular weight of 343.64 g/mol. Its IUPAC name is ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine.
Molecular Properties
| Compound Name | ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine |
| PubChem CID | 169134554 |
| Molecular Formula | C21H49N3 |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 343.39 |
| IUPAC Name | ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine |
| SMILES | CC.CC.CC1CCN(C(C)C)CC1.CN1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C9H19N.C8H18N2.2C2H6/c1-8(2)10-6-4-9(3)5-7-10;1-9(2)8-4-6-10(3)7-5-8;2*1-2/h8-9H,4-7H2,1-3H3;8H,4-7H2,1-3H3;2*1-2H3 |
| InChIKey | DRKXVQGNHIFUIM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine?
The IUPAC name of ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine (CID 169134554) is ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine.
What is the SMILES notation for ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine?
The canonical SMILES for ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine is CC.CC.CC1CCN(C(C)C)CC1.CN1CCC(N(C)C)CC1.
What is the InChIKey of ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine?
The InChIKey is DRKXVQGNHIFUIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C8H18N2.2C2H6/c1-8(2)10-6-4-9(3)5-7-10;1-9(2)8-4-6-10(3)7-5-8;2*1-2/h8-9H,4-7H2,1-3H3;8H,4-7H2,1-3H3;2*1-2H3.
What are the key properties of ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine?
ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine has a molecular weight of 343.64 g/mol, XLogP of 4.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-1-propan-2-ylpiperidine;N,N,1-trimethylpiperidin-4-amine is sourced from PubChem (CID 169134554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).