C14H27FO2 — CID 169134591
ethane;(3Z,5E)-6-fluoro-4-(2-methoxyethoxy)hepta-1,3,5-triene (PubChem CID 169134591) has the molecular formula C14H27FO2 and a molecular weight of 246.37 g/mol. Its IUPAC name is ethane;(3Z,5E)-6-fluoro-4-(2-methoxyethoxy)hepta-1,3,5-triene.
| Compound Name | ethane;(3Z,5E)-6-fluoro-4-(2-methoxyethoxy)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 169134591 |
| Molecular Formula | C14H27FO2 |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | ethane;(3Z,5E)-6-fluoro-4-(2-methoxyethoxy)hepta-1,3,5-triene |
| SMILES | C=C/C=C(/C=C(\C)F)OCCOC.CC.CC |
| InChI | InChI=1S/C10H15FO2.2C2H6/c1-4-5-10(8-9(2)11)13-7-6-12-3;2*1-2/h4-5,8H,1,6-7H2,2-3H3;2*1-2H3/b9-8+,10-5-;; |
| InChIKey | OUXVWUDLQSFEAR-CSWLRVBZSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|