C34H31F2N5O2S — CID 169134661
1-[2-[7-(2,4-difluoro-6-methoxyphenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one (PubChem CID 169134661) has the molecular formula C34H31F2N5O2S and a molecular weight of 611.72 g/mol. Its IUPAC name is 1-[2-[7-(2,4-difluoro-6-methoxyphenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[7-(2,4-difluoro-6-methoxyphenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169134661 |
| Molecular Formula | C34H31F2N5O2S |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.22 |
| IUPAC Name | 1-[2-[7-(2,4-difluoro-6-methoxyphenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1Cc2cc(-c3nc(-c4ccc5c(c4)CCN(C)C5)c4ccsc4c3-c3c(F)cc(F)cc3OC)nn2CC1C |
| InChI | InChI=1S/C34H31F2N5O2S/c1-5-29(42)40-18-24-15-27(38-41(24)16-19(40)2)33-31(30-26(36)13-23(35)14-28(30)43-4)34-25(9-11-44-34)32(37-33)21-6-7-22-17-39(3)10-8-20(22)12-21/h5-7,9,11-15,19H,1,8,10,16-18H2,2-4H3 |
| InChIKey | SWXYRIHYBRXVSV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|