C35H32FN5O4S — CID 169135105
7-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-[1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]pyrazol-4-yl]thieno[3,2-c]pyridin-4-yl]-2,4-dihydro-1H-isoquinolin-3-one (PubChem CID 169135105) has the molecular formula C35H32FN5O4S and a molecular weight of 637.74 g/mol. Its IUPAC name is 7-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-[1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]pyrazol-4-yl]thieno[3,2-c]pyridin-4-yl]-2,4-dihydro-1H-isoquinolin-3-one.
| Compound Name | 7-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-[1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]pyrazol-4-yl]thieno[3,2-c]pyridin-4-yl]-2,4-dihydro-1H-isoquinolin-3-one |
|---|---|
| PubChem CID | 169135105 |
| Molecular Formula | C35H32FN5O4S |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | 7-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-[1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]pyrazol-4-yl]thieno[3,2-c]pyridin-4-yl]-2,4-dihydro-1H-isoquinolin-3-one |
| SMILES | C=CC(=O)N1CC[C@H](n2cc(-c3nc(-c4ccc5c(c4)CNC(=O)C5)c4ccsc4c3-c3ccc(F)cc3OCCOC)cn2)C1 |
| InChI | InChI=1S/C35H32FN5O4S/c1-3-31(43)40-10-8-26(20-40)41-19-24(18-38-41)34-32(27-7-6-25(36)16-29(27)45-12-11-44-2)35-28(9-13-46-35)33(39-34)22-5-4-21-15-30(42)37-17-23(21)14-22/h3-7,9,13-14,16,18-19,26H,1,8,10-12,15,17,20H2,2H3,(H,37,42)/t26-/m0/s1 |
| InChIKey | YUPPUAVEVGZVIN-SANMLTNESA-N |
| XLogP | 5.79 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|