About 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane
2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane (PubChem CID 169135144) has the molecular formula C11H24F2N2O
and a molecular weight of 238.32 g/mol. Its IUPAC name is 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane.
Molecular Properties
| Compound Name | 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane |
| PubChem CID | 169135144 |
| Molecular Formula | C11H24F2N2O |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane |
| SMILES | CC.CNC1C(C)CN(CCO)CC1(F)F |
| InChI | InChI=1S/C9H18F2N2O.C2H6/c1-7-5-13(3-4-14)6-9(10,11)8(7)12-2;1-2/h7-8,12,14H,3-6H2,1-2H3;1-2H3 |
| InChIKey | HAIYIQYAWRIZPI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane?
The IUPAC name of 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane (CID 169135144) is 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane.
What is the SMILES notation for 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane?
The canonical SMILES for 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane is CC.CNC1C(C)CN(CCO)CC1(F)F.
What is the InChIKey of 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane?
The InChIKey is HAIYIQYAWRIZPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F2N2O.C2H6/c1-7-5-13(3-4-14)6-9(10,11)8(7)12-2;1-2/h7-8,12,14H,3-6H2,1-2H3;1-2H3.
What are the key properties of 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane?
2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane has a molecular weight of 238.32 g/mol, XLogP of 1.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,3-difluoro-5-methyl-4-(methylamino)piperidin-1-yl]ethanol;ethane is sourced from PubChem (CID 169135144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).