C38H38FN3O3S — CID 169135203
N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]cyclopentanecarboxamide (PubChem CID 169135203) has the molecular formula C38H38FN3O3S and a molecular weight of 635.81 g/mol. Its IUPAC name is N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]cyclopentanecarboxamide.
| Compound Name | N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 169135203 |
| Molecular Formula | C38H38FN3O3S |
| Molecular Weight | 635.81 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]cyclopentanecarboxamide |
| SMILES | COCCOc1cc(F)ccc1-c1c(-c2cccc(CNC(=O)C3CCCC3)c2)nc(-c2ccc3c(c2)CCNC3)c2ccsc12 |
| InChI | InChI=1S/C38H38FN3O3S/c1-44-16-17-45-33-21-30(39)11-12-31(33)34-36(27-8-4-5-24(19-27)22-41-38(43)25-6-2-3-7-25)42-35(32-14-18-46-37(32)34)28-9-10-29-23-40-15-13-26(29)20-28/h4-5,8-12,14,18-21,25,40H,2-3,6-7,13,15-17,22-23H2,1H3,(H,41,43) |
| InChIKey | BZNXBZMTMKFXAL-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.81 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|