C35H32FN3O3S — CID 169135245
N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]prop-2-enamide (PubChem CID 169135245) has the molecular formula C35H32FN3O3S and a molecular weight of 593.72 g/mol. Its IUPAC name is N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 169135245 |
| Molecular Formula | C35H32FN3O3S |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cccc(-c2nc(-c3ccc4c(c3)CCNC4)c3ccsc3c2-c2ccc(F)cc2OCCOC)c1 |
| InChI | InChI=1S/C35H32FN3O3S/c1-3-31(40)38-20-22-5-4-6-24(17-22)34-32(28-10-9-27(36)19-30(28)42-15-14-41-2)35-29(12-16-43-35)33(39-34)25-7-8-26-21-37-13-11-23(26)18-25/h3-10,12,16-19,37H,1,11,13-15,20-21H2,2H3,(H,38,40) |
| InChIKey | LOOILRNDZYCJFU-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|