C35H32FN3O3S — CID 169135756
N-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide (PubChem CID 169135756) has the molecular formula C35H32FN3O3S and a molecular weight of 593.72 g/mol. Its IUPAC name is N-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 169135756 |
| Molecular Formula | C35H32FN3O3S |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | N-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(-c3ccc4c(c3)CCN(C)C4)c3ccsc3c2-c2ccc(F)cc2OCCOC)c1 |
| InChI | InChI=1S/C35H32FN3O3S/c1-4-31(40)37-27-7-5-6-23(19-27)34-32(28-11-10-26(36)20-30(28)42-16-15-41-3)35-29(13-17-43-35)33(38-34)24-8-9-25-21-39(2)14-12-22(25)18-24/h4-11,13,17-20H,1,12,14-16,21H2,2-3H3,(H,37,40) |
| InChIKey | OPSBJPJFQAOUSA-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|