C37H34FN3O3S — CID 169135828
1-[7-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one (PubChem CID 169135828) has the molecular formula C37H34FN3O3S and a molecular weight of 619.76 g/mol. Its IUPAC name is 1-[7-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169135828 |
| Molecular Formula | C37H34FN3O3S |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.23 |
| IUPAC Name | 1-[7-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2ccc(-c3nc(-c4ccc5c(c4)CCNC5)c4ccsc4c3-c3ccc(F)cc3OCCOC)cc2C1 |
| InChI | InChI=1S/C37H34FN3O3S/c1-3-33(42)41-14-11-23-4-5-26(19-28(23)22-41)36-34(30-9-8-29(38)20-32(30)44-16-15-43-2)37-31(12-17-45-37)35(40-36)25-6-7-27-21-39-13-10-24(27)18-25/h3-9,12,17-20,39H,1,10-11,13-16,21-22H2,2H3 |
| InChIKey | BQNBQEOEAGCAAJ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|