C33H32FN5O3S — CID 169135855
N-[2-[4-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]pyrazol-1-yl]ethyl]prop-2-enamide (PubChem CID 169135855) has the molecular formula C33H32FN5O3S and a molecular weight of 597.72 g/mol. Its IUPAC name is N-[2-[4-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]pyrazol-1-yl]ethyl]prop-2-enamide.
| Compound Name | N-[2-[4-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]pyrazol-1-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 169135855 |
| Molecular Formula | C33H32FN5O3S |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | N-[2-[4-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]pyrazol-1-yl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCn1cc(-c2nc(-c3ccc4c(c3)CCNC4)c3ccsc3c2-c2ccc(F)cc2OCCOC)cn1 |
| InChI | InChI=1S/C33H32FN5O3S/c1-3-29(40)36-11-12-39-20-24(19-37-39)32-30(26-7-6-25(34)17-28(26)42-14-13-41-2)33-27(9-15-43-33)31(38-32)22-4-5-23-18-35-10-8-21(23)16-22/h3-7,9,15-17,19-20,35H,1,8,10-14,18H2,2H3,(H,36,40) |
| InChIKey | OTNOILGUTHWARN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|