C35H34FN3O2S — CID 169135962
7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridine (PubChem CID 169135962) has the molecular formula C35H34FN3O2S and a molecular weight of 579.74 g/mol. Its IUPAC name is 7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridine.
| Compound Name | 7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 169135962 |
| Molecular Formula | C35H34FN3O2S |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridine |
| SMILES | COCCOc1cc(F)ccc1-c1c(-c2ccc3c(c2)CCN(C)C3)nc(-c2ccc3c(c2)CCNC3)c2ccsc12 |
| InChI | InChI=1S/C35H34FN3O2S/c1-39-13-10-23-18-25(4-6-27(23)21-39)34-32(29-8-7-28(36)19-31(29)41-15-14-40-2)35-30(11-16-42-35)33(38-34)24-3-5-26-20-37-12-9-22(26)17-24/h3-8,11,16-19,37H,9-10,12-15,20-21H2,1-2H3 |
| InChIKey | LTEQYSVCAHVRKB-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|