C32H29FN4O3S2 — CID 169135995
N-[[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1,3-thiazol-4-yl]methyl]prop-2-enamide (PubChem CID 169135995) has the molecular formula C32H29FN4O3S2 and a molecular weight of 600.74 g/mol. Its IUPAC name is N-[[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1,3-thiazol-4-yl]methyl]prop-2-enamide.
| Compound Name | N-[[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1,3-thiazol-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 169135995 |
| Molecular Formula | C32H29FN4O3S2 |
| Molecular Weight | 600.74 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | N-[[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1,3-thiazol-4-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1csc(-c2nc(-c3ccc4c(c3)CCNC4)c3ccsc3c2-c2ccc(F)cc2OCCOC)n1 |
| InChI | InChI=1S/C32H29FN4O3S2/c1-3-27(38)35-17-23-18-42-32(36-23)30-28(24-7-6-22(33)15-26(24)40-12-11-39-2)31-25(9-13-41-31)29(37-30)20-4-5-21-16-34-10-8-19(21)14-20/h3-7,9,13-15,18,34H,1,8,10-12,16-17H2,2H3,(H,35,38) |
| InChIKey | UMPVFDGVBAQIFL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.74 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|