C34H31FN4O3S2 — CID 169136002
1-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one (PubChem CID 169136002) has the molecular formula C34H31FN4O3S2 and a molecular weight of 626.78 g/mol. Its IUPAC name is 1-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169136002 |
| Molecular Formula | C34H31FN4O3S2 |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | 1-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2nc(-c3nc(-c4ccc5c(c4)CCNC5)c4ccsc4c3-c3ccc(F)cc3OCCOC)sc2C1 |
| InChI | InChI=1S/C34H31FN4O3S2/c1-3-29(40)39-12-9-26-28(19-39)44-34(37-26)32-30(24-7-6-23(35)17-27(24)42-14-13-41-2)33-25(10-15-43-33)31(38-32)21-4-5-22-18-36-11-8-20(22)16-21/h3-7,10,15-17,36H,1,8-9,11-14,18-19H2,2H3 |
| InChIKey | GGGVXBLKXWWANA-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|