C33H28FN3O2S — CID 169136033
7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-(1H-indol-6-yl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridine (PubChem CID 169136033) has the molecular formula C33H28FN3O2S and a molecular weight of 549.67 g/mol. Its IUPAC name is 7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-(1H-indol-6-yl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridine.
| Compound Name | 7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-(1H-indol-6-yl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 169136033 |
| Molecular Formula | C33H28FN3O2S |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-(1H-indol-6-yl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridine |
| SMILES | COCCOc1cc(F)ccc1-c1c(-c2ccc3cc[nH]c3c2)nc(-c2ccc3c(c2)CCNC3)c2ccsc12 |
| InChI | InChI=1S/C33H28FN3O2S/c1-38-13-14-39-29-18-25(34)6-7-26(29)30-32(23-3-2-20-9-12-36-28(20)17-23)37-31(27-10-15-40-33(27)30)22-4-5-24-19-35-11-8-21(24)16-22/h2-7,9-10,12,15-18,35-36H,8,11,13-14,19H2,1H3 |
| InChIKey | WHMVKFAIUOTJCW-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|