About ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine
ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine (PubChem CID 169136046) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine.
Molecular Properties
| Compound Name | ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| PubChem CID | 169136046 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| SMILES | CC.Cc1nc(C)c2c(c1C)CCC2 |
| InChI | InChI=1S/C11H15N.C2H6/c1-7-8(2)12-9(3)11-6-4-5-10(7)11;1-2/h4-6H2,1-3H3;1-2H3 |
| InChIKey | YRAKZBLCSBRAKI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
The IUPAC name of ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine (CID 169136046) is ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine.
What is the SMILES notation for ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
The canonical SMILES for ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine is CC.Cc1nc(C)c2c(c1C)CCC2.
What is the InChIKey of ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
The InChIKey is YRAKZBLCSBRAKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C2H6/c1-7-8(2)12-9(3)11-6-4-5-10(7)11;1-2/h4-6H2,1-3H3;1-2H3.
What are the key properties of ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine has a molecular weight of 191.32 g/mol, XLogP of 3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,3,4-trimethyl-6,7-dihydro-5H-cyclopenta[c]pyridine is sourced from PubChem (CID 169136046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).