About 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane
1-(2,2-difluoroethyl)-4-methylpyrazole;ethane (PubChem CID 169136137) has the molecular formula C10H20F2N2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane |
| PubChem CID | 169136137 |
| Molecular Formula | C10H20F2N2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane |
| SMILES | CC.CC.Cc1cnn(CC(F)F)c1 |
| InChI | InChI=1S/C6H8F2N2.2C2H6/c1-5-2-9-10(3-5)4-6(7)8;2*1-2/h2-3,6H,4H2,1H3;2*1-2H3 |
| InChIKey | YDDGKDYZNFQJIK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane?
The IUPAC name of 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane (CID 169136137) is 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane.
What is the SMILES notation for 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane?
The canonical SMILES for 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane is CC.CC.Cc1cnn(CC(F)F)c1.
What is the InChIKey of 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane?
The InChIKey is YDDGKDYZNFQJIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N2.2C2H6/c1-5-2-9-10(3-5)4-6(7)8;2*1-2/h2-3,6H,4H2,1H3;2*1-2H3.
What are the key properties of 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane?
1-(2,2-difluoroethyl)-4-methylpyrazole;ethane has a molecular weight of 206.28 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-4-methylpyrazole;ethane is sourced from PubChem (CID 169136137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).