C11H16N2 — CID 169136210
3,5,6-trimethyl-7,8-dihydro-5H-1,6-naphthyridine (PubChem CID 169136210) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3,5,6-trimethyl-7,8-dihydro-5H-1,6-naphthyridine.
| Compound Name | 3,5,6-trimethyl-7,8-dihydro-5H-1,6-naphthyridine |
|---|---|
| PubChem CID | 169136210 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3,5,6-trimethyl-7,8-dihydro-5H-1,6-naphthyridine |
| SMILES | Cc1cnc2c(c1)C(C)N(C)CC2 |
| InChI | InChI=1S/C11H16N2/c1-8-6-10-9(2)13(3)5-4-11(10)12-7-8/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | GHQQPQDMAQNUHS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |