C38H36F2N4O2S — CID 169136284
1-[3-[7-(2,4-difluoro-6-propan-2-yloxyphenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-7-methyl-7,8-dihydro-5H-1,6-naphthyridin-6-yl]prop-2-en-1-one (PubChem CID 169136284) has the molecular formula C38H36F2N4O2S and a molecular weight of 650.80 g/mol. Its IUPAC name is 1-[3-[7-(2,4-difluoro-6-propan-2-yloxyphenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-7-methyl-7,8-dihydro-5H-1,6-naphthyridin-6-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[7-(2,4-difluoro-6-propan-2-yloxyphenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-7-methyl-7,8-dihydro-5H-1,6-naphthyridin-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169136284 |
| Molecular Formula | C38H36F2N4O2S |
| Molecular Weight | 650.80 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | 1-[3-[7-(2,4-difluoro-6-propan-2-yloxyphenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-7-methyl-7,8-dihydro-5H-1,6-naphthyridin-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1Cc2cc(-c3nc(-c4ccc5c(c4)CCN(C)C5)c4ccsc4c3-c3c(F)cc(F)cc3OC(C)C)cnc2CC1C |
| InChI | InChI=1S/C38H36F2N4O2S/c1-6-33(45)44-20-27-15-26(18-41-31(27)13-22(44)4)37-35(34-30(40)16-28(39)17-32(34)46-21(2)3)38-29(10-12-47-38)36(42-37)24-7-8-25-19-43(5)11-9-23(25)14-24/h6-8,10,12,14-18,21-22H,1,9,11,13,19-20H2,2-5H3 |
| InChIKey | KQADOYJRQBQUQF-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.80 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|