C30H33F6N5O4 — CID 169137445
2-[5-amino-6-[5-[2-(cyclohexa-1,5-dien-1-ylmethoxy)-6-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-1,1,1-trifluorohexan-2-yl]-1,3,4-oxadiazol-2-yl]-3-(trifluoromethyl)-2-pyridinyl]acetic acid (PubChem CID 169137445) has the molecular formula C30H33F6N5O4 and a molecular weight of 641.61 g/mol. Its IUPAC name is 2-[5-amino-6-[5-[2-(cyclohexa-1,5-dien-1-ylmethoxy)-6-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-1,1,1-trifluorohexan-2-yl]-1,3,4-oxadiazol-2-yl]-3-(trifluoromethyl)-2-pyridinyl]acetic acid.
| Compound Name | 2-[5-amino-6-[5-[2-(cyclohexa-1,5-dien-1-ylmethoxy)-6-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-1,1,1-trifluorohexan-2-yl]-1,3,4-oxadiazol-2-yl]-3-(trifluoromethyl)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 169137445 |
| Molecular Formula | C30H33F6N5O4 |
| Molecular Weight | 641.61 g/mol |
| Exact Mass | 641.24 |
| IUPAC Name | 2-[5-amino-6-[5-[2-(cyclohexa-1,5-dien-1-ylmethoxy)-6-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-1,1,1-trifluorohexan-2-yl]-1,3,4-oxadiazol-2-yl]-3-(trifluoromethyl)-2-pyridinyl]acetic acid |
| SMILES | C=C/C=C(\C=C)CNCCCCC(OCC1=CCCC=C1)(c1nnc(-c2nc(CC(=O)O)c(C(F)(F)F)cc2N)o1)C(F)(F)F |
| InChI | InChI=1S/C30H33F6N5O4/c1-3-10-19(4-2)17-38-14-9-8-13-28(30(34,35)36,44-18-20-11-6-5-7-12-20)27-41-40-26(45-27)25-22(37)15-21(29(31,32)33)23(39-25)16-24(42)43/h3-4,6,10-12,15,38H,1-2,5,7-9,13-14,16-18,37H2,(H,42,43)/b19-10+ |
| InChIKey | HSIIXYQUWXQCRH-VXLYETTFSA-N |
| XLogP | 6.47 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|