About 8-sulfonyl-1-benzazepine
8-sulfonyl-1-benzazepine (PubChem CID 169137509) has the molecular formula C10H7NO2S
and a molecular weight of 205.24 g/mol. Its IUPAC name is 8-sulfonyl-1-benzazepine.
Molecular Properties
| Compound Name | 8-sulfonyl-1-benzazepine |
| PubChem CID | 169137509 |
| Molecular Formula | C10H7NO2S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 8-sulfonyl-1-benzazepine |
| SMILES | O=S(=O)=c1ccc2ccccnc-2c1 |
| InChI | InChI=1S/C10H7NO2S/c12-14(13)9-5-4-8-3-1-2-6-11-10(8)7-9/h1-7H |
| InChIKey | VDWVCUVCOILVBX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 8-sulfonyl-1-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-sulfonyl-1-benzazepine?
The IUPAC name of 8-sulfonyl-1-benzazepine (CID 169137509) is 8-sulfonyl-1-benzazepine.
What is the SMILES notation for 8-sulfonyl-1-benzazepine?
The canonical SMILES for 8-sulfonyl-1-benzazepine is O=S(=O)=c1ccc2ccccnc-2c1.
What is the InChIKey of 8-sulfonyl-1-benzazepine?
The InChIKey is VDWVCUVCOILVBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2S/c12-14(13)9-5-4-8-3-1-2-6-11-10(8)7-9/h1-7H.
What are the key properties of 8-sulfonyl-1-benzazepine?
8-sulfonyl-1-benzazepine has a molecular weight of 205.24 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-sulfonyl-1-benzazepine is sourced from PubChem (CID 169137509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).