C16H25F3N4OS — CID 169137646
(Z)-2-[amino(methyl)amino]ethenamine;2-(2,2,2-trifluoroethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 169137646) has the molecular formula C16H25F3N4OS and a molecular weight of 378.46 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]ethenamine;2-(2,2,2-trifluoroethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (Z)-2-[amino(methyl)amino]ethenamine;2-(2,2,2-trifluoroethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 169137646 |
| Molecular Formula | C16H25F3N4OS |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]ethenamine;2-(2,2,2-trifluoroethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | CN(N)/C=C\N.FC(F)(F)Cc1cc2c(s1)C1(CCNCC1)OCC2 |
| InChI | InChI=1S/C13H16F3NOS.C3H9N3/c14-13(15,16)8-10-7-9-1-6-18-12(11(9)19-10)2-4-17-5-3-12;1-6(5)3-2-4/h7,17H,1-6,8H2;2-3H,4-5H2,1H3/b;3-2- |
| InChIKey | JZPJFDPGKIAGSD-AHNKWOMYSA-N |
| XLogP | 2.23 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|