C15H21F3N4OS — CID 169137664
(Z)-2-[amino(methyl)amino]-1-[2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]ethenamine (PubChem CID 169137664) has the molecular formula C15H21F3N4OS and a molecular weight of 362.42 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-[2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]ethenamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-[2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]ethenamine |
|---|---|
| PubChem CID | 169137664 |
| Molecular Formula | C15H21F3N4OS |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-[2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]ethenamine |
| SMILES | CN(N)/C=C(\N)C1CC2(CCN1)OCCc1cc(C(F)(F)F)sc12 |
| InChI | InChI=1S/C15H21F3N4OS/c1-22(20)8-10(19)11-7-14(3-4-21-11)13-9(2-5-23-14)6-12(24-13)15(16,17)18/h6,8,11,21H,2-5,7,19-20H2,1H3/b10-8- |
| InChIKey | IGOICTOURYEYQV-NTMALXAHSA-N |
| XLogP | 1.89 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|