C18H26F2N4OS — CID 169137754
(Z)-2-[amino(methyl)amino]-1-[2-(3,3-difluorocyclobutyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]ethenamine (PubChem CID 169137754) has the molecular formula C18H26F2N4OS and a molecular weight of 384.50 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-[2-(3,3-difluorocyclobutyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]ethenamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-[2-(3,3-difluorocyclobutyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]ethenamine |
|---|---|
| PubChem CID | 169137754 |
| Molecular Formula | C18H26F2N4OS |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-[2-(3,3-difluorocyclobutyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]ethenamine |
| SMILES | CN(N)/C=C(\N)C1CC2(CCN1)OCCc1cc(C3CC(F)(F)C3)sc12 |
| InChI | InChI=1S/C18H26F2N4OS/c1-24(22)10-13(21)14-9-17(3-4-23-14)16-11(2-5-25-17)6-15(26-16)12-7-18(19,20)8-12/h6,10,12,14,23H,2-5,7-9,21-22H2,1H3/b13-10- |
| InChIKey | OBBGJTFIBNYETK-RAXLEYEMSA-N |
| XLogP | 2.39 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|