About ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol
ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol (PubChem CID 169138109) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol.
Molecular Properties
| Compound Name | ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol |
| PubChem CID | 169138109 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol |
| SMILES | CC.Oc1ccc2c(c1)CCOC21CCNCC1 |
| InChI | InChI=1S/C13H17NO2.C2H6/c15-11-1-2-12-10(9-11)3-8-16-13(12)4-6-14-7-5-13;1-2/h1-2,9,14-15H,3-8H2;1-2H3 |
| InChIKey | CWGJWIUHCPYMPX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol?
The IUPAC name of ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol (CID 169138109) is ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol.
What is the SMILES notation for ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol?
The canonical SMILES for ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol is CC.Oc1ccc2c(c1)CCOC21CCNCC1.
What is the InChIKey of ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol?
The InChIKey is CWGJWIUHCPYMPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2.C2H6/c15-11-1-2-12-10(9-11)3-8-16-13(12)4-6-14-7-5-13;1-2/h1-2,9,14-15H,3-8H2;1-2H3.
What are the key properties of ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol?
ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol has a molecular weight of 249.35 g/mol, XLogP of 2.57, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;spiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol is sourced from PubChem (CID 169138109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).