About (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol
(2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol (PubChem CID 169138120) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol.
Molecular Properties
| Compound Name | (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol |
| PubChem CID | 169138120 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol |
| SMILES | C[C@H]1CC2(CCN1)OCCc1cc(O)ccc12 |
| InChI | InChI=1S/C14H19NO2/c1-10-9-14(5-6-15-10)13-3-2-12(16)8-11(13)4-7-17-14/h2-3,8,10,15-16H,4-7,9H2,1H3/t10-,14?/m0/s1 |
| InChIKey | MKGRIBQFMGMCSN-XLLULAGJSA-N |
| XLogP | 1.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol?
The IUPAC name of (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol (CID 169138120) is (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol.
What is the SMILES notation for (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol?
The canonical SMILES for (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol is C[C@H]1CC2(CCN1)OCCc1cc(O)ccc12.
What is the InChIKey of (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol?
The InChIKey is MKGRIBQFMGMCSN-XLLULAGJSA-N. The full InChI is InChI=1S/C14H19NO2/c1-10-9-14(5-6-15-10)13-3-2-12(16)8-11(13)4-7-17-14/h2-3,8,10,15-16H,4-7,9H2,1H3/t10-,14?/m0/s1.
What are the key properties of (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol?
(2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol has a molecular weight of 233.31 g/mol, XLogP of 1.93, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2'S)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol is sourced from PubChem (CID 169138120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).