About 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol
7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol (PubChem CID 169138396) has the molecular formula C13H16ClNO2
and a molecular weight of 253.73 g/mol. Its IUPAC name is 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol.
Molecular Properties
| Compound Name | 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol |
| PubChem CID | 169138396 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol |
| SMILES | Oc1cc2c(cc1Cl)C1(CCNCC1)OCC2 |
| InChI | InChI=1S/C13H16ClNO2/c14-11-8-10-9(7-12(11)16)1-6-17-13(10)2-4-15-5-3-13/h7-8,15-16H,1-6H2 |
| InChIKey | HNLLXJGNTWGTOK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol?
The IUPAC name of 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol (CID 169138396) is 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol.
What is the SMILES notation for 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol?
The canonical SMILES for 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol is Oc1cc2c(cc1Cl)C1(CCNCC1)OCC2.
What is the InChIKey of 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol?
The InChIKey is HNLLXJGNTWGTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO2/c14-11-8-10-9(7-12(11)16)1-6-17-13(10)2-4-15-5-3-13/h7-8,15-16H,1-6H2.
What are the key properties of 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol?
7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol has a molecular weight of 253.73 g/mol, XLogP of 2.20, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol is sourced from PubChem (CID 169138396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).