C20H31F4NOS — CID 169138502
ethane;1'-prop-1-en-2-yl-2-(1,1,2,2-tetrafluoroethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 169138502) has the molecular formula C20H31F4NOS and a molecular weight of 409.53 g/mol. Its IUPAC name is ethane;1'-prop-1-en-2-yl-2-(1,1,2,2-tetrafluoroethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | ethane;1'-prop-1-en-2-yl-2-(1,1,2,2-tetrafluoroethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 169138502 |
| Molecular Formula | C20H31F4NOS |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | ethane;1'-prop-1-en-2-yl-2-(1,1,2,2-tetrafluoroethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | C=C(C)N1CCC2(CC1)OCCc1cc(C(F)(F)C(F)F)sc12.CC.CC |
| InChI | InChI=1S/C16H19F4NOS.2C2H6/c1-10(2)21-6-4-15(5-7-21)13-11(3-8-22-15)9-12(23-13)16(19,20)14(17)18;2*1-2/h9,14H,1,3-8H2,2H3;2*1-2H3 |
| InChIKey | ORFLWEBPIJJVLE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|