C19H28F2N2OS — CID 169138537
3-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]cyclobutan-1-amine (PubChem CID 169138537) has the molecular formula C19H28F2N2OS and a molecular weight of 370.51 g/mol. Its IUPAC name is 3-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]cyclobutan-1-amine.
| Compound Name | 3-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 169138537 |
| Molecular Formula | C19H28F2N2OS |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]cyclobutan-1-amine |
| SMILES | C[C@H]1C[C@@]2(CCN1CC1CC(N)C1)OCCc1cc(CC(F)F)sc12 |
| InChI | InChI=1S/C19H28F2N2OS/c1-12-10-19(3-4-23(12)11-13-6-15(22)7-13)18-14(2-5-24-19)8-16(25-18)9-17(20)21/h8,12-13,15,17H,2-7,9-11,22H2,1H3/t12-,13?,15?,19+/m0/s1 |
| InChIKey | AMNAYNQZALSHAX-RALPTLIQSA-N |
| XLogP | 3.55 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |