C20H24F2N2O2S — CID 169138590
6-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]-1H-pyridin-2-one (PubChem CID 169138590) has the molecular formula C20H24F2N2O2S and a molecular weight of 394.49 g/mol. Its IUPAC name is 6-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]-1H-pyridin-2-one.
| Compound Name | 6-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 169138590 |
| Molecular Formula | C20H24F2N2O2S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 6-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]-1H-pyridin-2-one |
| SMILES | C[C@H]1C[C@@]2(CCN1Cc1cccc(=O)[nH]1)OCCc1cc(CC(F)F)sc12 |
| InChI | InChI=1S/C20H24F2N2O2S/c1-13-11-20(6-7-24(13)12-15-3-2-4-18(25)23-15)19-14(5-8-26-20)9-16(27-19)10-17(21)22/h2-4,9,13,17H,5-8,10-12H2,1H3,(H,23,25)/t13-,20+/m0/s1 |
| InChIKey | UZBIUCMPUMOZMU-RNODOKPDSA-N |
| XLogP | 3.70 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |