C14H16F3NO2S — CID 169138648
2,2,2-trifluoro-1-[(2'S,7R)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]ethanone (PubChem CID 169138648) has the molecular formula C14H16F3NO2S and a molecular weight of 319.35 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(2'S,7R)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(2'S,7R)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]ethanone |
|---|---|
| PubChem CID | 169138648 |
| Molecular Formula | C14H16F3NO2S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2,2,2-trifluoro-1-[(2'S,7R)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]ethanone |
| SMILES | C[C@H]1C[C@@]2(CCN1C(=O)C(F)(F)F)OCCc1ccsc12 |
| InChI | InChI=1S/C14H16F3NO2S/c1-9-8-13(4-5-18(9)12(19)14(15,16)17)11-10(2-6-20-13)3-7-21-11/h3,7,9H,2,4-6,8H2,1H3/t9-,13+/m0/s1 |
| InChIKey | XNDKNANAWGPJCG-TVQRCGJNSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |