About [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine
[1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine (PubChem CID 169138659) has the molecular formula C8H12N6O
and a molecular weight of 208.22 g/mol. Its IUPAC name is [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine |
| PubChem CID | 169138659 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine |
| SMILES | Cc1nc(CCn2cc(CN)nn2)no1 |
| InChI | InChI=1S/C8H12N6O/c1-6-10-8(12-15-6)2-3-14-5-7(4-9)11-13-14/h5H,2-4,9H2,1H3 |
| InChIKey | OBYBXRVPTBOAHN-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine?
The IUPAC name of [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine (CID 169138659) is [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine.
What is the SMILES notation for [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine?
The canonical SMILES for [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine is Cc1nc(CCn2cc(CN)nn2)no1.
What is the InChIKey of [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine?
The InChIKey is OBYBXRVPTBOAHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6O/c1-6-10-8(12-15-6)2-3-14-5-7(4-9)11-13-14/h5H,2-4,9H2,1H3.
What are the key properties of [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine?
[1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine has a molecular weight of 208.22 g/mol, XLogP of -0.33, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]triazol-4-yl]methanamine is sourced from PubChem (CID 169138659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).